C11H11F2N3O2S — CID 175500553
3-[2-(2,4-difluorophenoxy)ethylsulfanylmethyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 175500553) has the molecular formula C11H11F2N3O2S and a molecular weight of 287.29 g/mol. Its IUPAC name is 3-[2-(2,4-difluorophenoxy)ethylsulfanylmethyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[2-(2,4-difluorophenoxy)ethylsulfanylmethyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 175500553 |
| Molecular Formula | C11H11F2N3O2S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-[2-(2,4-difluorophenoxy)ethylsulfanylmethyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(CSCCOc2ccc(F)cc2F)[nH]1 |
| InChI | InChI=1S/C11H11F2N3O2S/c12-7-1-2-9(8(13)5-7)18-3-4-19-6-10-14-11(17)16-15-10/h1-2,5H,3-4,6H2,(H2,14,15,16,17) |
| InChIKey | CHRGBSCCMUVHEK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|