C12H12F2N2O3S — CID 175500583
5-[3-(2,4-difluorophenoxy)propylsulfanylmethyl]-3H-1,3,4-oxadiazol-2-one (PubChem CID 175500583) has the molecular formula C12H12F2N2O3S and a molecular weight of 302.30 g/mol. Its IUPAC name is 5-[3-(2,4-difluorophenoxy)propylsulfanylmethyl]-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[3-(2,4-difluorophenoxy)propylsulfanylmethyl]-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 175500583 |
| Molecular Formula | C12H12F2N2O3S |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 5-[3-(2,4-difluorophenoxy)propylsulfanylmethyl]-3H-1,3,4-oxadiazol-2-one |
| SMILES | O=c1[nH]nc(CSCCCOc2ccc(F)cc2F)o1 |
| InChI | InChI=1S/C12H12F2N2O3S/c13-8-2-3-10(9(14)6-8)18-4-1-5-20-7-11-15-16-12(17)19-11/h2-3,6H,1,4-5,7H2,(H,16,17) |
| InChIKey | GEVYXORMEPZKDY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|