C10H12F3NO — CID 175501954
2-phenyl-N-(1,2,2-trifluoroethoxy)ethanamine (PubChem CID 175501954) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is 2-phenyl-N-(1,2,2-trifluoroethoxy)ethanamine.
| Compound Name | 2-phenyl-N-(1,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 175501954 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-phenyl-N-(1,2,2-trifluoroethoxy)ethanamine |
| SMILES | FC(F)C(F)ONCCc1ccccc1 |
| InChI | InChI=1S/C10H12F3NO/c11-9(12)10(13)15-14-7-6-8-4-2-1-3-5-8/h1-5,9-10,14H,6-7H2 |
| InChIKey | KDNIRHMZPSETBB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|