About 2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one
2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one (PubChem CID 175502046) has the molecular formula C14H12BrClO
and a molecular weight of 311.61 g/mol. Its IUPAC name is 2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one.
Molecular Properties
| Compound Name | 2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one |
| PubChem CID | 175502046 |
| Molecular Formula | C14H12BrClO |
| Molecular Weight | 311.61 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one |
| SMILES | O=C1CCC2(CC1Cl)C(Br)=Cc1ccccc12 |
| InChI | InChI=1S/C14H12BrClO/c15-13-7-9-3-1-2-4-10(9)14(13)6-5-12(17)11(16)8-14/h1-4,7,11H,5-6,8H2 |
| InChIKey | ZHVXLMJRALHXRH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one?
The IUPAC name of 2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one (CID 175502046) is 2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one.
What is the SMILES notation for 2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one?
The canonical SMILES for 2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one is O=C1CCC2(CC1Cl)C(Br)=Cc1ccccc12.
What is the InChIKey of 2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one?
The InChIKey is ZHVXLMJRALHXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrClO/c15-13-7-9-3-1-2-4-10(9)14(13)6-5-12(17)11(16)8-14/h1-4,7,11H,5-6,8H2.
What are the key properties of 2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one?
2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one has a molecular weight of 311.61 g/mol, XLogP of 4.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-bromo-2-chlorospiro[cyclohexane-4,1'-indene]-1-one is sourced from PubChem (CID 175502046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).