About dichloropalladium;tricyclopentylphosphane
dichloropalladium;tricyclopentylphosphane (PubChem CID 175504069) has the molecular formula C15H27Cl2PPd
and a molecular weight of 415.68 g/mol. Its IUPAC name is dichloropalladium;tricyclopentylphosphane.
Molecular Properties
| Compound Name | dichloropalladium;tricyclopentylphosphane |
| PubChem CID | 175504069 |
| Molecular Formula | C15H27Cl2PPd |
| Molecular Weight | 415.68 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | dichloropalladium;tricyclopentylphosphane |
| SMILES | C1CCC(P(C2CCCC2)C2CCCC2)C1.Cl[Pd]Cl |
| InChI | InChI=1S/C15H27P.2ClH.Pd/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;;;/h13-15H,1-12H2;2*1H;/q;;;+2/p-2 |
| InChIKey | OVSSAMQYSHFBCG-UHFFFAOYSA-L |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.68 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloropalladium;tricyclopentylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloropalladium;tricyclopentylphosphane?
The IUPAC name of dichloropalladium;tricyclopentylphosphane (CID 175504069) is dichloropalladium;tricyclopentylphosphane.
What is the SMILES notation for dichloropalladium;tricyclopentylphosphane?
The canonical SMILES for dichloropalladium;tricyclopentylphosphane is C1CCC(P(C2CCCC2)C2CCCC2)C1.Cl[Pd]Cl.
What is the InChIKey of dichloropalladium;tricyclopentylphosphane?
The InChIKey is OVSSAMQYSHFBCG-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H27P.2ClH.Pd/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;;;/h13-15H,1-12H2;2*1H;/q;;;+2/p-2.
What are the key properties of dichloropalladium;tricyclopentylphosphane?
dichloropalladium;tricyclopentylphosphane has a molecular weight of 415.68 g/mol, XLogP of 6.67, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloropalladium;tricyclopentylphosphane is sourced from PubChem (CID 175504069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).