About sodium;copper(1+);quinolin-8-yl phosphite
sodium;copper(1+);quinolin-8-yl phosphite (PubChem CID 175504092) has the molecular formula C9H6CuNNaO3P
and a molecular weight of 293.66 g/mol. Its IUPAC name is sodium;copper(1+);quinolin-8-yl phosphite.
Molecular Properties
| Compound Name | sodium;copper(1+);quinolin-8-yl phosphite |
| PubChem CID | 175504092 |
| Molecular Formula | C9H6CuNNaO3P |
| Molecular Weight | 293.66 g/mol |
| Exact Mass | 292.93 |
| IUPAC Name | sodium;copper(1+);quinolin-8-yl phosphite |
| SMILES | [Cu+].[Na+].[O-]P([O-])Oc1cccc2cccnc12 |
| InChI | InChI=1S/C9H6NO3P.Cu.Na/c11-14(12)13-8-5-1-3-7-4-2-6-10-9(7)8;;/h1-6H;;/q-2;2*+1 |
| InChIKey | UOYSNYLPSVUTMD-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 68.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.66 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;copper(1+);quinolin-8-yl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;copper(1+);quinolin-8-yl phosphite?
The IUPAC name of sodium;copper(1+);quinolin-8-yl phosphite (CID 175504092) is sodium;copper(1+);quinolin-8-yl phosphite.
What is the SMILES notation for sodium;copper(1+);quinolin-8-yl phosphite?
The canonical SMILES for sodium;copper(1+);quinolin-8-yl phosphite is [Cu+].[Na+].[O-]P([O-])Oc1cccc2cccnc12.
What is the InChIKey of sodium;copper(1+);quinolin-8-yl phosphite?
The InChIKey is UOYSNYLPSVUTMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6NO3P.Cu.Na/c11-14(12)13-8-5-1-3-7-4-2-6-10-9(7)8;;/h1-6H;;/q-2;2*+1.
What are the key properties of sodium;copper(1+);quinolin-8-yl phosphite?
sodium;copper(1+);quinolin-8-yl phosphite has a molecular weight of 293.66 g/mol, XLogP of -2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;copper(1+);quinolin-8-yl phosphite is sourced from PubChem (CID 175504092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).