C21H21IN2O5S — CID 175504283
2-[2-iodo-1-(2-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-1-(oxan-4-yl)ethanone (PubChem CID 175504283) has the molecular formula C21H21IN2O5S and a molecular weight of 540.38 g/mol. Its IUPAC name is 2-[2-iodo-1-(2-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-1-(oxan-4-yl)ethanone.
| Compound Name | 2-[2-iodo-1-(2-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-1-(oxan-4-yl)ethanone |
|---|---|
| PubChem CID | 175504283 |
| Molecular Formula | C21H21IN2O5S |
| Molecular Weight | 540.38 g/mol |
| Exact Mass | 540.02 |
| IUPAC Name | 2-[2-iodo-1-(2-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]oxy-1-(oxan-4-yl)ethanone |
| SMILES | Cc1ccccc1S(=O)(=O)n1c(I)cc2c(OCC(=O)C3CCOCC3)ccnc21 |
| InChI | InChI=1S/C21H21IN2O5S/c1-14-4-2-3-5-19(14)30(26,27)24-20(22)12-16-18(6-9-23-21(16)24)29-13-17(25)15-7-10-28-11-8-15/h2-6,9,12,15H,7-8,10-11,13H2,1H3 |
| InChIKey | ZOKQJZFKANJMJU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|