C9H12O5S — CID 175504354
7-methyl-3,8a-dihydro-2H-1,4-benzodioxine-4a-sulfonic acid (PubChem CID 175504354) has the molecular formula C9H12O5S and a molecular weight of 232.26 g/mol. Its IUPAC name is 7-methyl-3,8a-dihydro-2H-1,4-benzodioxine-4a-sulfonic acid.
| Compound Name | 7-methyl-3,8a-dihydro-2H-1,4-benzodioxine-4a-sulfonic acid |
|---|---|
| PubChem CID | 175504354 |
| Molecular Formula | C9H12O5S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 7-methyl-3,8a-dihydro-2H-1,4-benzodioxine-4a-sulfonic acid |
| SMILES | CC1=CC2OCCOC2(S(=O)(=O)O)C=C1 |
| InChI | InChI=1S/C9H12O5S/c1-7-2-3-9(15(10,11)12)8(6-7)13-4-5-14-9/h2-3,6,8H,4-5H2,1H3,(H,10,11,12) |
| InChIKey | FZZBABVOKNHGQV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|