About 1aH-oxireno[2,3-h]isoquinolin-7-one
1aH-oxireno[2,3-h]isoquinolin-7-one (PubChem CID 175504478) has the molecular formula C9H5NO2
and a molecular weight of 159.14 g/mol. Its IUPAC name is 1aH-oxireno[2,3-h]isoquinolin-7-one.
Molecular Properties
| Compound Name | 1aH-oxireno[2,3-h]isoquinolin-7-one |
| PubChem CID | 175504478 |
| Molecular Formula | C9H5NO2 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | 1aH-oxireno[2,3-h]isoquinolin-7-one |
| SMILES | O=C1N=CC=C2C=CC3OC3=C12 |
| InChI | InChI=1S/C9H5NO2/c11-9-7-5(3-4-10-9)1-2-6-8(7)12-6/h1-4,6H |
| InChIKey | HJOVSYCMSHBUOZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 41.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1aH-oxireno[2,3-h]isoquinolin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1aH-oxireno[2,3-h]isoquinolin-7-one?
The IUPAC name of 1aH-oxireno[2,3-h]isoquinolin-7-one (CID 175504478) is 1aH-oxireno[2,3-h]isoquinolin-7-one.
What is the SMILES notation for 1aH-oxireno[2,3-h]isoquinolin-7-one?
The canonical SMILES for 1aH-oxireno[2,3-h]isoquinolin-7-one is O=C1N=CC=C2C=CC3OC3=C12.
What is the InChIKey of 1aH-oxireno[2,3-h]isoquinolin-7-one?
The InChIKey is HJOVSYCMSHBUOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO2/c11-9-7-5(3-4-10-9)1-2-6-8(7)12-6/h1-4,6H.
What are the key properties of 1aH-oxireno[2,3-h]isoquinolin-7-one?
1aH-oxireno[2,3-h]isoquinolin-7-one has a molecular weight of 159.14 g/mol, XLogP of 0.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1aH-oxireno[2,3-h]isoquinolin-7-one is sourced from PubChem (CID 175504478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).