C19H22N4O3 — CID 175504758
2-[2-[2-(6,7,8,9-tetrahydro-3H-benzo[e]benzimidazol-2-yl)ethylamino]ethyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 175504758) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[2-[2-(6,7,8,9-tetrahydro-3H-benzo[e]benzimidazol-2-yl)ethylamino]ethyl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[2-[2-(6,7,8,9-tetrahydro-3H-benzo[e]benzimidazol-2-yl)ethylamino]ethyl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 175504758 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[2-[2-(6,7,8,9-tetrahydro-3H-benzo[e]benzimidazol-2-yl)ethylamino]ethyl]-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(CCNCCc2nc3c4c(ccc3[nH]2)CCCC4)n1 |
| InChI | InChI=1S/C19H22N4O3/c24-19(25)15-11-26-17(22-15)8-10-20-9-7-16-21-14-6-5-12-3-1-2-4-13(12)18(14)23-16/h5-6,11,20H,1-4,7-10H2,(H,21,23)(H,24,25) |
| InChIKey | KCXFAHHRRNMFIZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|