About 4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid
4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid (PubChem CID 175504979) has the molecular formula C16H21F2NO4
and a molecular weight of 329.34 g/mol. Its IUPAC name is 4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid.
Molecular Properties
| Compound Name | 4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid |
| PubChem CID | 175504979 |
| Molecular Formula | C16H21F2NO4 |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid |
| SMILES | COC(OC)C1CCN(Cc2c(F)cc(C(=O)O)cc2F)CC1 |
| InChI | InChI=1S/C16H21F2NO4/c1-22-16(23-2)10-3-5-19(6-4-10)9-12-13(17)7-11(15(20)21)8-14(12)18/h7-8,10,16H,3-6,9H2,1-2H3,(H,20,21) |
| InChIKey | JSWIKYKBASIGGF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid?
The IUPAC name of 4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid (CID 175504979) is 4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid.
What is the SMILES notation for 4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid?
The canonical SMILES for 4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid is COC(OC)C1CCN(Cc2c(F)cc(C(=O)O)cc2F)CC1.
What is the InChIKey of 4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid?
The InChIKey is JSWIKYKBASIGGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F2NO4/c1-22-16(23-2)10-3-5-19(6-4-10)9-12-13(17)7-11(15(20)21)8-14(12)18/h7-8,10,16H,3-6,9H2,1-2H3,(H,20,21).
What are the key properties of 4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid?
4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid has a molecular weight of 329.34 g/mol, XLogP of 2.49, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(dimethoxymethyl)piperidin-1-yl]methyl]-3,5-difluorobenzoic acid is sourced from PubChem (CID 175504979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).