C22H24F4N2O — CID 175505562
N-ethyl-N'-[4-[4-fluoro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-N,2-dimethylprop-2-enimidamide (PubChem CID 175505562) has the molecular formula C22H24F4N2O and a molecular weight of 408.44 g/mol. Its IUPAC name is N-ethyl-N'-[4-[4-fluoro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-N,2-dimethylprop-2-enimidamide.
| Compound Name | N-ethyl-N'-[4-[4-fluoro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-N,2-dimethylprop-2-enimidamide |
|---|---|
| PubChem CID | 175505562 |
| Molecular Formula | C22H24F4N2O |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-ethyl-N'-[4-[4-fluoro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-N,2-dimethylprop-2-enimidamide |
| SMILES | C=C(C)/C(=N\c1cc(C)c(Oc2ccc(F)c(C(F)(F)F)c2)cc1C)N(C)CC |
| InChI | InChI=1S/C22H24F4N2O/c1-7-28(6)21(13(2)3)27-19-10-15(5)20(11-14(19)4)29-16-8-9-18(23)17(12-16)22(24,25)26/h8-12H,2,7H2,1,3-6H3/b27-21+ |
| InChIKey | RGIQDEGYYYYQGT-SZXQPVLSSA-N |
| XLogP | 6.81 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|