About 3-(dimethylamino)propyl decane-1-sulfonate
3-(dimethylamino)propyl decane-1-sulfonate (PubChem CID 175505827) has the molecular formula C15H33NO3S
and a molecular weight of 307.50 g/mol. Its IUPAC name is 3-(dimethylamino)propyl decane-1-sulfonate.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl decane-1-sulfonate |
| PubChem CID | 175505827 |
| Molecular Formula | C15H33NO3S |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | 3-(dimethylamino)propyl decane-1-sulfonate |
| SMILES | CCCCCCCCCCS(=O)(=O)OCCCN(C)C |
| InChI | InChI=1S/C15H33NO3S/c1-4-5-6-7-8-9-10-11-15-20(17,18)19-14-12-13-16(2)3/h4-15H2,1-3H3 |
| InChIKey | CTMUJHHPZLFPDD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl decane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl decane-1-sulfonate?
The IUPAC name of 3-(dimethylamino)propyl decane-1-sulfonate (CID 175505827) is 3-(dimethylamino)propyl decane-1-sulfonate.
What is the SMILES notation for 3-(dimethylamino)propyl decane-1-sulfonate?
The canonical SMILES for 3-(dimethylamino)propyl decane-1-sulfonate is CCCCCCCCCCS(=O)(=O)OCCCN(C)C.
What is the InChIKey of 3-(dimethylamino)propyl decane-1-sulfonate?
The InChIKey is CTMUJHHPZLFPDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33NO3S/c1-4-5-6-7-8-9-10-11-15-20(17,18)19-14-12-13-16(2)3/h4-15H2,1-3H3.
What are the key properties of 3-(dimethylamino)propyl decane-1-sulfonate?
3-(dimethylamino)propyl decane-1-sulfonate has a molecular weight of 307.50 g/mol, XLogP of 3.43, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl decane-1-sulfonate is sourced from PubChem (CID 175505827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).