About 3,4-dimethyl-2,3-dihydrothiophen-2-amine
3,4-dimethyl-2,3-dihydrothiophen-2-amine (PubChem CID 175507457) has the molecular formula C6H11NS
and a molecular weight of 129.23 g/mol. Its IUPAC name is 3,4-dimethyl-2,3-dihydrothiophen-2-amine.
Molecular Properties
| Compound Name | 3,4-dimethyl-2,3-dihydrothiophen-2-amine |
| PubChem CID | 175507457 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 3,4-dimethyl-2,3-dihydrothiophen-2-amine |
| SMILES | CC1=CSC(N)C1C |
| InChI | InChI=1S/C6H11NS/c1-4-3-8-6(7)5(4)2/h3,5-6H,7H2,1-2H3 |
| InChIKey | FNBIZUQGGDPNRB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dimethyl-2,3-dihydrothiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2,3-dihydrothiophen-2-amine?
The IUPAC name of 3,4-dimethyl-2,3-dihydrothiophen-2-amine (CID 175507457) is 3,4-dimethyl-2,3-dihydrothiophen-2-amine.
What is the SMILES notation for 3,4-dimethyl-2,3-dihydrothiophen-2-amine?
The canonical SMILES for 3,4-dimethyl-2,3-dihydrothiophen-2-amine is CC1=CSC(N)C1C.
What is the InChIKey of 3,4-dimethyl-2,3-dihydrothiophen-2-amine?
The InChIKey is FNBIZUQGGDPNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NS/c1-4-3-8-6(7)5(4)2/h3,5-6H,7H2,1-2H3.
What are the key properties of 3,4-dimethyl-2,3-dihydrothiophen-2-amine?
3,4-dimethyl-2,3-dihydrothiophen-2-amine has a molecular weight of 129.23 g/mol, XLogP of 1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2,3-dihydrothiophen-2-amine is sourced from PubChem (CID 175507457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).