About lithium;hydride;1H-pyrimidine-2,4-dione
lithium;hydride;1H-pyrimidine-2,4-dione (PubChem CID 175507563) has the molecular formula C4H5LiN2O2
and a molecular weight of 120.04 g/mol. Its IUPAC name is lithium;hydride;1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | lithium;hydride;1H-pyrimidine-2,4-dione |
| PubChem CID | 175507563 |
| Molecular Formula | C4H5LiN2O2 |
| Molecular Weight | 120.04 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | lithium;hydride;1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc[nH]c(=O)[nH]1.[H-].[Li+] |
| InChI | InChI=1S/C4H4N2O2.Li.H/c7-3-1-2-5-4(8)6-3;;/h1-2H,(H2,5,6,7,8);;/q;+1;-1 |
| InChIKey | OXYSBECJWDSYOH-UHFFFAOYSA-N |
| XLogP | -3.82 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.04 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium;hydride;1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;1H-pyrimidine-2,4-dione?
The IUPAC name of lithium;hydride;1H-pyrimidine-2,4-dione (CID 175507563) is lithium;hydride;1H-pyrimidine-2,4-dione.
What is the SMILES notation for lithium;hydride;1H-pyrimidine-2,4-dione?
The canonical SMILES for lithium;hydride;1H-pyrimidine-2,4-dione is O=c1cc[nH]c(=O)[nH]1.[H-].[Li+].
What is the InChIKey of lithium;hydride;1H-pyrimidine-2,4-dione?
The InChIKey is OXYSBECJWDSYOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.Li.H/c7-3-1-2-5-4(8)6-3;;/h1-2H,(H2,5,6,7,8);;/q;+1;-1.
What are the key properties of lithium;hydride;1H-pyrimidine-2,4-dione?
lithium;hydride;1H-pyrimidine-2,4-dione has a molecular weight of 120.04 g/mol, XLogP of -3.82, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;1H-pyrimidine-2,4-dione is sourced from PubChem (CID 175507563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).