C17H14BrF3N4 — CID 175507893
2-bromo-N-[1-(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)-1,2,2-trifluoroethyl]pyridin-4-amine (PubChem CID 175507893) has the molecular formula C17H14BrF3N4 and a molecular weight of 411.23 g/mol. Its IUPAC name is 2-bromo-N-[1-(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)-1,2,2-trifluoroethyl]pyridin-4-amine.
| Compound Name | 2-bromo-N-[1-(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)-1,2,2-trifluoroethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 175507893 |
| Molecular Formula | C17H14BrF3N4 |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 2-bromo-N-[1-(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)-1,2,2-trifluoroethyl]pyridin-4-amine |
| SMILES | FC(F)C(F)(Nc1ccnc(Br)c1)c1cn2cc(C3CC3)ccc2n1 |
| InChI | InChI=1S/C17H14BrF3N4/c18-14-7-12(5-6-22-14)24-17(21,16(19)20)13-9-25-8-11(10-1-2-10)3-4-15(25)23-13/h3-10,16H,1-2H2,(H,22,24) |
| InChIKey | ZXFROPDVHHCXTA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|