C5H5F4NO — CID 175508382
2,4,5,5-tetrafluoropent-2-enamide (PubChem CID 175508382) has the molecular formula C5H5F4NO and a molecular weight of 171.09 g/mol. Its IUPAC name is 2,4,5,5-tetrafluoropent-2-enamide.
| Compound Name | 2,4,5,5-tetrafluoropent-2-enamide |
|---|---|
| PubChem CID | 175508382 |
| Molecular Formula | C5H5F4NO |
| Molecular Weight | 171.09 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | 2,4,5,5-tetrafluoropent-2-enamide |
| SMILES | NC(=O)C(F)=CC(F)C(F)F |
| InChI | InChI=1S/C5H5F4NO/c6-2(4(8)9)1-3(7)5(10)11/h1-2,4H,(H2,10,11) |
| InChIKey | WHRQSMXPLMHVJK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.09 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|