C2H9N3O10 — CID 175508543
1-N,1-N,1-N',1-N',2-N,2-N,1-heptahydroxyethane-1,1,2-triamine oxide (PubChem CID 175508543) has the molecular formula C2H9N3O10 and a molecular weight of 235.10 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',2-N,2-N,1-heptahydroxyethane-1,1,2-triamine oxide.
| Compound Name | 1-N,1-N,1-N',1-N',2-N,2-N,1-heptahydroxyethane-1,1,2-triamine oxide |
|---|---|
| PubChem CID | 175508543 |
| Molecular Formula | C2H9N3O10 |
| Molecular Weight | 235.10 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 1-N,1-N,1-N',1-N',2-N,2-N,1-heptahydroxyethane-1,1,2-triamine oxide |
| SMILES | [O-][N+](O)(O)CC(O)([N+]([O-])(O)O)[N+]([O-])(O)O |
| InChI | InChI=1S/C2H9N3O10/c6-2(4(10,11)12,5(13,14)15)1-3(7,8)9/h6-8,10-11,13-14H,1H2 |
| InChIKey | OFSODZWHHGBDSY-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 210.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.10 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|