C10H3Cl2N3O2 — CID 175508595
acetonitrile;4,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile (PubChem CID 175508595) has the molecular formula C10H3Cl2N3O2 and a molecular weight of 268.06 g/mol. Its IUPAC name is acetonitrile;4,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile.
| Compound Name | acetonitrile;4,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 175508595 |
| Molecular Formula | C10H3Cl2N3O2 |
| Molecular Weight | 268.06 g/mol |
| Exact Mass | 266.96 |
| IUPAC Name | acetonitrile;4,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile |
| SMILES | CC#N.N#CC1=C(C#N)C(=O)C(Cl)=C(Cl)C1=O |
| InChI | InChI=1S/C8Cl2N2O2.C2H3N/c9-5-6(10)8(14)4(2-12)3(1-11)7(5)13;1-2-3/h;1H3 |
| InChIKey | GINGTWMSPYGCNR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 105.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.06 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|