About CID 175509052
CID 175509052 (PubChem CID 175509052) has the molecular formula C5H3N2O3S2-
and a molecular weight of 203.22 g/mol.
Molecular Properties
| Compound Name | CID 175509052 |
| PubChem CID | 175509052 |
| Molecular Formula | C5H3N2O3S2- |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 202.96 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1cccnc1[S-](=O)=S |
| InChI | InChI=1S/C5H3N2O3S2/c8-7(9)4-2-1-3-6-5(4)12(10)11/h1-3H/q-1 |
| InChIKey | BMZBTYJPUOKMCI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 175509052 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175509052?
The IUPAC name of CID 175509052 (CID 175509052) is not available.
What is the SMILES notation for CID 175509052?
The canonical SMILES for CID 175509052 is O=[N+]([O-])c1cccnc1[S-](=O)=S.
What is the InChIKey of CID 175509052?
The InChIKey is BMZBTYJPUOKMCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N2O3S2/c8-7(9)4-2-1-3-6-5(4)12(10)11/h1-3H/q-1.
What are the key properties of CID 175509052?
CID 175509052 has a molecular weight of 203.22 g/mol, XLogP of 0.77, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175509052 is sourced from PubChem (CID 175509052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).