About (3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine
(3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine (PubChem CID 175509132) has the molecular formula C12H11FN2O
and a molecular weight of 218.23 g/mol. Its IUPAC name is (3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine.
Molecular Properties
| Compound Name | (3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine |
| PubChem CID | 175509132 |
| Molecular Formula | C12H11FN2O |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine |
| SMILES | C[C@H]1OCc2c1c(N)nc1cc(F)ccc21 |
| InChI | InChI=1S/C12H11FN2O/c1-6-11-9(5-16-6)8-3-2-7(13)4-10(8)15-12(11)14/h2-4,6H,5H2,1H3,(H2,14,15)/t6-/m1/s1 |
| InChIKey | UGYQJZBGHLRKMB-ZCFIWIBFSA-N |
| XLogP | 2.55 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine?
The IUPAC name of (3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine (CID 175509132) is (3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine.
What is the SMILES notation for (3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine?
The canonical SMILES for (3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine is C[C@H]1OCc2c1c(N)nc1cc(F)ccc21.
What is the InChIKey of (3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine?
The InChIKey is UGYQJZBGHLRKMB-ZCFIWIBFSA-N. The full InChI is InChI=1S/C12H11FN2O/c1-6-11-9(5-16-6)8-3-2-7(13)4-10(8)15-12(11)14/h2-4,6H,5H2,1H3,(H2,14,15)/t6-/m1/s1.
What are the key properties of (3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine?
(3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine has a molecular weight of 218.23 g/mol, XLogP of 2.55, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-7-fluoro-3-methyl-1,3-dihydrofuro[3,4-c]quinolin-4-amine is sourced from PubChem (CID 175509132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).