About 7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine
7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine (PubChem CID 175509211) has the molecular formula C11H9FN2O
and a molecular weight of 204.20 g/mol. Its IUPAC name is 7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine.
Molecular Properties
| Compound Name | 7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine |
| PubChem CID | 175509211 |
| Molecular Formula | C11H9FN2O |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine |
| SMILES | Nc1nc2cc(F)ccc2c2c1COC2 |
| InChI | InChI=1S/C11H9FN2O/c12-6-1-2-7-8-4-15-5-9(8)11(13)14-10(7)3-6/h1-3H,4-5H2,(H2,13,14) |
| InChIKey | TYDCHAARMLHVAI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine?
The IUPAC name of 7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine (CID 175509211) is 7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine.
What is the SMILES notation for 7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine?
The canonical SMILES for 7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine is Nc1nc2cc(F)ccc2c2c1COC2.
What is the InChIKey of 7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine?
The InChIKey is TYDCHAARMLHVAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2O/c12-6-1-2-7-8-4-15-5-9(8)11(13)14-10(7)3-6/h1-3H,4-5H2,(H2,13,14).
What are the key properties of 7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine?
7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine has a molecular weight of 204.20 g/mol, XLogP of 1.99, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1,3-dihydrofuro[3,4-c]quinolin-4-amine is sourced from PubChem (CID 175509211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).