C8H11F3O3 — CID 175510064
cyclohexanone;2,2,2-trifluoroacetic acid (PubChem CID 175510064) has the molecular formula C8H11F3O3 and a molecular weight of 212.17 g/mol. Its IUPAC name is cyclohexanone;2,2,2-trifluoroacetic acid.
| Compound Name | cyclohexanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175510064 |
| Molecular Formula | C8H11F3O3 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | cyclohexanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CCCCC1 |
| InChI | InChI=1S/C6H10O.C2HF3O2/c7-6-4-2-1-3-5-6;3-2(4,5)1(6)7/h1-5H2;(H,6,7) |
| InChIKey | ZYEFWVYGXULTOH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |