About 2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid
2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid (PubChem CID 175510479) has the molecular formula C18H25BO6
and a molecular weight of 348.20 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid.
Molecular Properties
| Compound Name | 2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid |
| PubChem CID | 175510479 |
| Molecular Formula | C18H25BO6 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid |
| SMILES | CC(C)(O)C(C)(C)O.OB(O)Oc1ccc(-c2ccccc2O)cc1 |
| InChI | InChI=1S/C12H11BO4.C6H14O2/c14-12-4-2-1-3-11(12)9-5-7-10(8-6-9)17-13(15)16;1-5(2,7)6(3,4)8/h1-8,14-16H;7-8H,1-4H3 |
| InChIKey | JVOAIHPSZOZSSJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid?
The IUPAC name of 2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid (CID 175510479) is 2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid.
What is the SMILES notation for 2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid?
The canonical SMILES for 2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid is CC(C)(O)C(C)(C)O.OB(O)Oc1ccc(-c2ccccc2O)cc1.
What is the InChIKey of 2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid?
The InChIKey is JVOAIHPSZOZSSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BO4.C6H14O2/c14-12-4-2-1-3-11(12)9-5-7-10(8-6-9)17-13(15)16;1-5(2,7)6(3,4)8/h1-8,14-16H;7-8H,1-4H3.
What are the key properties of 2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid?
2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid has a molecular weight of 348.20 g/mol, XLogP of 1.94, 4 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutane-2,3-diol;[4-(2-hydroxyphenyl)phenoxy]boronic acid is sourced from PubChem (CID 175510479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).