C19H34S — CID 175510577
5-methyl-5-(octylsulfanylmethyl)-6-propylcyclohexa-1,3-diene (PubChem CID 175510577) has the molecular formula C19H34S and a molecular weight of 294.55 g/mol. Its IUPAC name is 5-methyl-5-(octylsulfanylmethyl)-6-propylcyclohexa-1,3-diene.
| Compound Name | 5-methyl-5-(octylsulfanylmethyl)-6-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175510577 |
| Molecular Formula | C19H34S |
| Molecular Weight | 294.55 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | 5-methyl-5-(octylsulfanylmethyl)-6-propylcyclohexa-1,3-diene |
| SMILES | CCCCCCCCSCC1(C)C=CC=CC1CCC |
| InChI | InChI=1S/C19H34S/c1-4-6-7-8-9-12-16-20-17-19(3)15-11-10-14-18(19)13-5-2/h10-11,14-15,18H,4-9,12-13,16-17H2,1-3H3 |
| InChIKey | YAMLIVIBLUWQFC-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.55 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|