About cyclopropanecarbohydrazide;7H-purine
cyclopropanecarbohydrazide;7H-purine (PubChem CID 175511307) has the molecular formula C9H12N6O
and a molecular weight of 220.24 g/mol. Its IUPAC name is cyclopropanecarbohydrazide;7H-purine.
Molecular Properties
| Compound Name | cyclopropanecarbohydrazide;7H-purine |
| PubChem CID | 175511307 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | cyclopropanecarbohydrazide;7H-purine |
| SMILES | NNC(=O)C1CC1.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H4N4.C4H8N2O/c1-4-5(8-2-6-1)9-3-7-4;5-6-4(7)3-1-2-3/h1-3H,(H,6,7,8,9);3H,1-2,5H2,(H,6,7) |
| InChIKey | JXUPCEXHIVFSEN-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclopropanecarbohydrazide;7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanecarbohydrazide;7H-purine?
The IUPAC name of cyclopropanecarbohydrazide;7H-purine (CID 175511307) is cyclopropanecarbohydrazide;7H-purine.
What is the SMILES notation for cyclopropanecarbohydrazide;7H-purine?
The canonical SMILES for cyclopropanecarbohydrazide;7H-purine is NNC(=O)C1CC1.c1ncc2[nH]cnc2n1.
What is the InChIKey of cyclopropanecarbohydrazide;7H-purine?
The InChIKey is JXUPCEXHIVFSEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4.C4H8N2O/c1-4-5(8-2-6-1)9-3-7-4;5-6-4(7)3-1-2-3/h1-3H,(H,6,7,8,9);3H,1-2,5H2,(H,6,7).
What are the key properties of cyclopropanecarbohydrazide;7H-purine?
cyclopropanecarbohydrazide;7H-purine has a molecular weight of 220.24 g/mol, XLogP of -0.26, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanecarbohydrazide;7H-purine is sourced from PubChem (CID 175511307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).