About (6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate
(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate (PubChem CID 175511413) has the molecular formula C16H14ClN5O2
and a molecular weight of 343.77 g/mol. Its IUPAC name is (6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate.
Molecular Properties
| Compound Name | (6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate |
| PubChem CID | 175511413 |
| Molecular Formula | C16H14ClN5O2 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate |
| SMILES | O=C(Nc1cc(Cl)ncn1)OCc1cn2cc(C3CC3)ccc2n1 |
| InChI | InChI=1S/C16H14ClN5O2/c17-13-5-14(19-9-18-13)21-16(23)24-8-12-7-22-6-11(10-1-2-10)3-4-15(22)20-12/h3-7,9-10H,1-2,8H2,(H,18,19,21,23) |
| InChIKey | NNELBPJRSCVNDO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate?
The IUPAC name of (6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate (CID 175511413) is (6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate.
What is the SMILES notation for (6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate?
The canonical SMILES for (6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate is O=C(Nc1cc(Cl)ncn1)OCc1cn2cc(C3CC3)ccc2n1.
What is the InChIKey of (6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate?
The InChIKey is NNELBPJRSCVNDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN5O2/c17-13-5-14(19-9-18-13)21-16(23)24-8-12-7-22-6-11(10-1-2-10)3-4-15(22)20-12/h3-7,9-10H,1-2,8H2,(H,18,19,21,23).
What are the key properties of (6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate?
(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate has a molecular weight of 343.77 g/mol, XLogP of 3.40, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl N-(6-chloropyrimidin-4-yl)carbamate is sourced from PubChem (CID 175511413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).