C9H12N4O7S2 — CID 175512114
(Z)-but-2-enedioic acid;N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)acetamide (PubChem CID 175512114) has the molecular formula C9H12N4O7S2 and a molecular weight of 352.35 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)acetamide.
| Compound Name | (Z)-but-2-enedioic acid;N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 175512114 |
| Molecular Formula | C9H12N4O7S2 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)acetamide |
| SMILES | CC(=O)/N=c1\sc(S(N)(=O)=O)nn1C.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C5H8N4O3S2.C4H4O4/c1-3(10)7-4-9(2)8-5(13-4)14(6,11)12;5-3(6)1-2-4(7)8/h1-2H3,(H2,6,11,12);1-2H,(H,5,6)(H,7,8)/b7-4-;2-1- |
| InChIKey | WAMGIULXFRLMOH-NUMKKJCXSA-N |
| XLogP | -1.71 |
| TPSA | 182.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|