About 6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one
6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one (PubChem CID 175513071) has the molecular formula C20H14Cl3N3O
and a molecular weight of 418.71 g/mol. Its IUPAC name is 6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one.
Molecular Properties
| Compound Name | 6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one |
| PubChem CID | 175513071 |
| Molecular Formula | C20H14Cl3N3O |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one |
| SMILES | CCN1Cc2cc(-c3cccc(-c4ccnc(Cl)c4Cl)c3Cl)ncc2C1=O |
| InChI | InChI=1S/C20H14Cl3N3O/c1-2-26-10-11-8-16(25-9-15(11)20(26)27)14-5-3-4-12(17(14)21)13-6-7-24-19(23)18(13)22/h3-9H,2,10H2,1H3 |
| InChIKey | DMDNTCQAAUHOJL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one?
The IUPAC name of 6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one (CID 175513071) is 6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one.
What is the SMILES notation for 6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one?
The canonical SMILES for 6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one is CCN1Cc2cc(-c3cccc(-c4ccnc(Cl)c4Cl)c3Cl)ncc2C1=O.
What is the InChIKey of 6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one?
The InChIKey is DMDNTCQAAUHOJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Cl3N3O/c1-2-26-10-11-8-16(25-9-15(11)20(26)27)14-5-3-4-12(17(14)21)13-6-7-24-19(23)18(13)22/h3-9H,2,10H2,1H3.
What are the key properties of 6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one?
6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one has a molecular weight of 418.71 g/mol, XLogP of 5.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-chloro-3-(2,3-dichloro-4-pyridinyl)phenyl]-2-ethyl-1H-pyrrolo[3,4-c]pyridin-3-one is sourced from PubChem (CID 175513071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).