C20H26Cl2N4O6S — CID 175513257
N-[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]-1,3-oxazole-2-carboxamide;sulfuric acid (PubChem CID 175513257) has the molecular formula C20H26Cl2N4O6S and a molecular weight of 521.42 g/mol. Its IUPAC name is N-[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]-1,3-oxazole-2-carboxamide;sulfuric acid.
| Compound Name | N-[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]-1,3-oxazole-2-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 175513257 |
| Molecular Formula | C20H26Cl2N4O6S |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | N-[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]-1,3-oxazole-2-carboxamide;sulfuric acid |
| SMILES | O=C(NC1CC(CCN2CCN(c3cccc(Cl)c3Cl)CC2)C1)c1ncco1.O=S(=O)(O)O |
| InChI | InChI=1S/C20H24Cl2N4O2.H2O4S/c21-16-2-1-3-17(18(16)22)26-9-7-25(8-10-26)6-4-14-12-15(13-14)24-19(27)20-23-5-11-28-20;1-5(2,3)4/h1-3,5,11,14-15H,4,6-10,12-13H2,(H,24,27);(H2,1,2,3,4) |
| InChIKey | CHOCBXXXRPFPEK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|