C20H25Cl2N5O5 — CID 175513258
N-[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]-1,3-oxazole-2-carboxamide;nitric acid (PubChem CID 175513258) has the molecular formula C20H25Cl2N5O5 and a molecular weight of 486.36 g/mol. Its IUPAC name is N-[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]-1,3-oxazole-2-carboxamide;nitric acid.
| Compound Name | N-[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]-1,3-oxazole-2-carboxamide;nitric acid |
|---|---|
| PubChem CID | 175513258 |
| Molecular Formula | C20H25Cl2N5O5 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | N-[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]-1,3-oxazole-2-carboxamide;nitric acid |
| SMILES | O=C(NC1CC(CCN2CCN(c3cccc(Cl)c3Cl)CC2)C1)c1ncco1.O=[N+]([O-])O |
| InChI | InChI=1S/C20H24Cl2N4O2.HNO3/c21-16-2-1-3-17(18(16)22)26-9-7-25(8-10-26)6-4-14-12-15(13-14)24-19(27)20-23-5-11-28-20;2-1(3)4/h1-3,5,11,14-15H,4,6-10,12-13H2,(H,24,27);(H,2,3,4) |
| InChIKey | RNFSPRHRKLVEPB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 124.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|