C32H33FN2O12S2 — CID 175513614
[5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-2-methyl-3H-1,3,4-oxadiazol-2-yl] 3-fluorobenzenesulfonate (PubChem CID 175513614) has the molecular formula C32H33FN2O12S2 and a molecular weight of 720.75 g/mol. Its IUPAC name is [5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-2-methyl-3H-1,3,4-oxadiazol-2-yl] 3-fluorobenzenesulfonate.
| Compound Name | [5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-2-methyl-3H-1,3,4-oxadiazol-2-yl] 3-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 175513614 |
| Molecular Formula | C32H33FN2O12S2 |
| Molecular Weight | 720.75 g/mol |
| Exact Mass | 720.15 |
| IUPAC Name | [5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-2-methyl-3H-1,3,4-oxadiazol-2-yl] 3-fluorobenzenesulfonate |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCSC3=NNC(C)(OS(=O)(=O)c4cccc(F)c4)O3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C32H33FN2O12S2/c1-32(47-49(37,38)21-10-7-9-19(33)15-21)35-34-31(46-32)48-12-8-11-44-30-27(36)26-22(40-3)16-20(39-2)17-23(26)45-28(30)18-13-24(41-4)29(43-6)25(14-18)42-5/h7,9-10,13-17,35H,8,11-12H2,1-6H3 |
| InChIKey | BRCXOORWECYSJE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 162.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.75 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|