About (2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride
(2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride (PubChem CID 175513971) has the molecular formula C6H15ClN2O4
and a molecular weight of 214.65 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride |
| PubChem CID | 175513971 |
| Molecular Formula | C6H15ClN2O4 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | (2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride |
| SMILES | COC(=O)CN.C[C@H](N)C(=O)O.Cl |
| InChI | InChI=1S/2C3H7NO2.ClH/c1-6-3(5)2-4;1-2(4)3(5)6;/h2,4H2,1H3;2H,4H2,1H3,(H,5,6);1H/t;2-;/m.0./s1 |
| InChIKey | MBRBGHYGARLQHC-TYOUJGAFSA-N |
| XLogP | -1.04 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride?
The IUPAC name of (2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride (CID 175513971) is (2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride.
What is the SMILES notation for (2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride?
The canonical SMILES for (2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride is COC(=O)CN.C[C@H](N)C(=O)O.Cl.
What is the InChIKey of (2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride?
The InChIKey is MBRBGHYGARLQHC-TYOUJGAFSA-N. The full InChI is InChI=1S/2C3H7NO2.ClH/c1-6-3(5)2-4;1-2(4)3(5)6;/h2,4H2,1H3;2H,4H2,1H3,(H,5,6);1H/t;2-;/m.0./s1.
What are the key properties of (2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride?
(2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride has a molecular weight of 214.65 g/mol, XLogP of -1.04, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopropanoic acid;methyl 2-aminoacetate;hydrochloride is sourced from PubChem (CID 175513971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).