C34H53FIN5O2Si2 — CID 175514505
[6-(5-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl)-3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyrazin-5-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 175514505) has the molecular formula C34H53FIN5O2Si2 and a molecular weight of 765.90 g/mol. Its IUPAC name is [6-(5-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl)-3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyrazin-5-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [6-(5-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl)-3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyrazin-5-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 175514505 |
| Molecular Formula | C34H53FIN5O2Si2 |
| Molecular Weight | 765.90 g/mol |
| Exact Mass | 765.28 |
| IUPAC Name | [6-(5-fluorospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl)-3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyrazin-5-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OCc1nc2c(I)nn(COCC[Si](C)(C)C)c2nc1N1CCC2(CC1)Cc1ccc(F)cc1C2)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H53FIN5O2Si2/c1-23(2)45(24(3)4,25(5)6)43-21-29-32(38-33-30(37-29)31(36)39-41(33)22-42-16-17-44(7,8)9)40-14-12-34(13-15-40)19-26-10-11-28(35)18-27(26)20-34/h10-11,18,23-25H,12-17,19-22H2,1-9H3 |
| InChIKey | FUQCAXYQBHGPIS-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.90 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|