C24H24F3N5O3S — CID 175515003
N-[(2-amino-3-pyridinyl)sulfonyl]-6-(2,4,5-trifluorophenyl)-2-(2,2,3-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide (PubChem CID 175515003) has the molecular formula C24H24F3N5O3S and a molecular weight of 519.55 g/mol. Its IUPAC name is N-[(2-amino-3-pyridinyl)sulfonyl]-6-(2,4,5-trifluorophenyl)-2-(2,2,3-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[(2-amino-3-pyridinyl)sulfonyl]-6-(2,4,5-trifluorophenyl)-2-(2,2,3-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175515003 |
| Molecular Formula | C24H24F3N5O3S |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | N-[(2-amino-3-pyridinyl)sulfonyl]-6-(2,4,5-trifluorophenyl)-2-(2,2,3-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide |
| SMILES | CC1CCN(c2nc(-c3cc(F)c(F)cc3F)ccc2C(=O)NS(=O)(=O)c2cccnc2N)C1(C)C |
| InChI | InChI=1S/C24H24F3N5O3S/c1-13-8-10-32(24(13,2)3)22-14(23(33)31-36(34,35)20-5-4-9-29-21(20)28)6-7-19(30-22)15-11-17(26)18(27)12-16(15)25/h4-7,9,11-13H,8,10H2,1-3H3,(H2,28,29)(H,31,33) |
| InChIKey | DDUGXRSZUSPEOK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|