C6H10N4O2S — CID 175515962
N-[2-hydroxy-2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)ethyl]acetamide (PubChem CID 175515962) has the molecular formula C6H10N4O2S and a molecular weight of 202.24 g/mol. Its IUPAC name is N-[2-hydroxy-2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)ethyl]acetamide.
| Compound Name | N-[2-hydroxy-2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 175515962 |
| Molecular Formula | C6H10N4O2S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | N-[2-hydroxy-2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)ethyl]acetamide |
| SMILES | CC(=O)NCC(O)c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C6H10N4O2S/c1-3(11)7-2-4(12)5-8-6(13)10-9-5/h4,12H,2H2,1H3,(H,7,11)(H2,8,9,10,13) |
| InChIKey | AFWBBRFKRHQSGT-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|