About 5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one
5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one (PubChem CID 175516077) has the molecular formula C10H10BrN3O3
and a molecular weight of 300.11 g/mol. Its IUPAC name is 5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one.
Molecular Properties
| Compound Name | 5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one |
| PubChem CID | 175516077 |
| Molecular Formula | C10H10BrN3O3 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one |
| SMILES | O=c1[nH]nc(C(O)CNc2cccc(Br)c2)o1 |
| InChI | InChI=1S/C10H10BrN3O3/c11-6-2-1-3-7(4-6)12-5-8(15)9-13-14-10(16)17-9/h1-4,8,12,15H,5H2,(H,14,16) |
| InChIKey | SOYHYDYLZIUVKO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one?
The IUPAC name of 5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one (CID 175516077) is 5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one.
What is the SMILES notation for 5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one?
The canonical SMILES for 5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one is O=c1[nH]nc(C(O)CNc2cccc(Br)c2)o1.
What is the InChIKey of 5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one?
The InChIKey is SOYHYDYLZIUVKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN3O3/c11-6-2-1-3-7(4-6)12-5-8(15)9-13-14-10(16)17-9/h1-4,8,12,15H,5H2,(H,14,16).
What are the key properties of 5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one?
5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one has a molecular weight of 300.11 g/mol, XLogP of 1.27, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3-bromoanilino)-1-hydroxyethyl]-3H-1,3,4-oxadiazol-2-one is sourced from PubChem (CID 175516077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).