About 3-sulfinyl-2H-indolizine
3-sulfinyl-2H-indolizine (PubChem CID 175516315) has the molecular formula C8H7NOS
and a molecular weight of 165.22 g/mol. Its IUPAC name is 3-sulfinyl-2H-indolizine.
Molecular Properties
| Compound Name | 3-sulfinyl-2H-indolizine |
| PubChem CID | 175516315 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 3-sulfinyl-2H-indolizine |
| SMILES | O=S=C1CC=C2C=CC=CN21 |
| InChI | InChI=1S/C8H7NOS/c10-11-8-5-4-7-3-1-2-6-9(7)8/h1-4,6H,5H2 |
| InChIKey | WOVXDHJQWRGGCB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfinyl-2H-indolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfinyl-2H-indolizine?
The IUPAC name of 3-sulfinyl-2H-indolizine (CID 175516315) is 3-sulfinyl-2H-indolizine.
What is the SMILES notation for 3-sulfinyl-2H-indolizine?
The canonical SMILES for 3-sulfinyl-2H-indolizine is O=S=C1CC=C2C=CC=CN21.
What is the InChIKey of 3-sulfinyl-2H-indolizine?
The InChIKey is WOVXDHJQWRGGCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NOS/c10-11-8-5-4-7-3-1-2-6-9(7)8/h1-4,6H,5H2.
What are the key properties of 3-sulfinyl-2H-indolizine?
3-sulfinyl-2H-indolizine has a molecular weight of 165.22 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfinyl-2H-indolizine is sourced from PubChem (CID 175516315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).