About sodium;hydride;hydroxymethyl tridecanoate
sodium;hydride;hydroxymethyl tridecanoate (PubChem CID 175516324) has the molecular formula C14H29NaO3
and a molecular weight of 268.37 g/mol. Its IUPAC name is sodium;hydride;hydroxymethyl tridecanoate.
Molecular Properties
| Compound Name | sodium;hydride;hydroxymethyl tridecanoate |
| PubChem CID | 175516324 |
| Molecular Formula | C14H29NaO3 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | sodium;hydride;hydroxymethyl tridecanoate |
| SMILES | CCCCCCCCCCCCC(=O)OCO.[H-].[Na+] |
| InChI | InChI=1S/C14H28O3.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-14(16)17-13-15;;/h15H,2-13H2,1H3;;/q;+1;-1 |
| InChIKey | DXJWZJOPPHMGTP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;hydroxymethyl tridecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;hydroxymethyl tridecanoate?
The IUPAC name of sodium;hydride;hydroxymethyl tridecanoate (CID 175516324) is sodium;hydride;hydroxymethyl tridecanoate.
What is the SMILES notation for sodium;hydride;hydroxymethyl tridecanoate?
The canonical SMILES for sodium;hydride;hydroxymethyl tridecanoate is CCCCCCCCCCCCC(=O)OCO.[H-].[Na+].
What is the InChIKey of sodium;hydride;hydroxymethyl tridecanoate?
The InChIKey is DXJWZJOPPHMGTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-14(16)17-13-15;;/h15H,2-13H2,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;hydroxymethyl tridecanoate?
sodium;hydride;hydroxymethyl tridecanoate has a molecular weight of 268.37 g/mol, XLogP of 0.91, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;hydroxymethyl tridecanoate is sourced from PubChem (CID 175516324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).