C15H15F3N2O4 — CID 175516461
1-(1,3-dihydroisoindol-2-yl)piperidine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 175516461) has the molecular formula C15H15F3N2O4 and a molecular weight of 344.29 g/mol. Its IUPAC name is 1-(1,3-dihydroisoindol-2-yl)piperidine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(1,3-dihydroisoindol-2-yl)piperidine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175516461 |
| Molecular Formula | C15H15F3N2O4 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 1-(1,3-dihydroisoindol-2-yl)piperidine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CCCC(=O)N1N1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H14N2O2.C2HF3O2/c16-12-6-3-7-13(17)15(12)14-8-10-4-1-2-5-11(10)9-14;3-2(4,5)1(6)7/h1-2,4-5H,3,6-9H2;(H,6,7) |
| InChIKey | OWSSRUJPNQJWMS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|