C30H36F3NO5 — CID 175516495
4-(dimethoxymethyl)-1-[4-[7-(oxan-2-yloxy)-3-(1,2,2-trifluoroethyl)-2H-chromen-4-yl]phenyl]piperidine (PubChem CID 175516495) has the molecular formula C30H36F3NO5 and a molecular weight of 547.61 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-1-[4-[7-(oxan-2-yloxy)-3-(1,2,2-trifluoroethyl)-2H-chromen-4-yl]phenyl]piperidine.
| Compound Name | 4-(dimethoxymethyl)-1-[4-[7-(oxan-2-yloxy)-3-(1,2,2-trifluoroethyl)-2H-chromen-4-yl]phenyl]piperidine |
|---|---|
| PubChem CID | 175516495 |
| Molecular Formula | C30H36F3NO5 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | 4-(dimethoxymethyl)-1-[4-[7-(oxan-2-yloxy)-3-(1,2,2-trifluoroethyl)-2H-chromen-4-yl]phenyl]piperidine |
| SMILES | COC(OC)C1CCN(c2ccc(C3=C(C(F)C(F)F)COc4cc(OC5CCCCO5)ccc43)cc2)CC1 |
| InChI | InChI=1S/C30H36F3NO5/c1-35-30(36-2)20-12-14-34(15-13-20)21-8-6-19(7-9-21)27-23-11-10-22(39-26-5-3-4-16-37-26)17-25(23)38-18-24(27)28(31)29(32)33/h6-11,17,20,26,28-30H,3-5,12-16,18H2,1-2H3 |
| InChIKey | OCSBTBCOWAGJCV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|