C12H10FN3O4S — CID 175516602
3-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorobenzoic acid (PubChem CID 175516602) has the molecular formula C12H10FN3O4S and a molecular weight of 311.29 g/mol. Its IUPAC name is 3-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorobenzoic acid.
| Compound Name | 3-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 175516602 |
| Molecular Formula | C12H10FN3O4S |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 3-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorobenzoic acid |
| SMILES | Cn1c(=S)n(C)c(=O)n(-c2cc(C(=O)O)ccc2F)c1=O |
| InChI | InChI=1S/C12H10FN3O4S/c1-14-10(19)16(11(20)15(2)12(14)21)8-5-6(9(17)18)3-4-7(8)13/h3-5H,1-2H3,(H,17,18) |
| InChIKey | OXNFVAFQRUKPNA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|