C22H22Cl2N4O5S — CID 175516606
2-phenylmethoxyiminopropyl 2,4-dichloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanyl-1,3,5-triazinan-1-yl)benzoate (PubChem CID 175516606) has the molecular formula C22H22Cl2N4O5S and a molecular weight of 525.41 g/mol. Its IUPAC name is 2-phenylmethoxyiminopropyl 2,4-dichloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanyl-1,3,5-triazinan-1-yl)benzoate.
| Compound Name | 2-phenylmethoxyiminopropyl 2,4-dichloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanyl-1,3,5-triazinan-1-yl)benzoate |
|---|---|
| PubChem CID | 175516606 |
| Molecular Formula | C22H22Cl2N4O5S |
| Molecular Weight | 525.41 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | 2-phenylmethoxyiminopropyl 2,4-dichloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanyl-1,3,5-triazinan-1-yl)benzoate |
| SMILES | CC(COC(=O)c1cc(N2C(=O)N(C)C(S)N(C)C2=O)c(Cl)cc1Cl)=NOCc1ccccc1 |
| InChI | InChI=1S/C22H22Cl2N4O5S/c1-13(25-33-12-14-7-5-4-6-8-14)11-32-19(29)15-9-18(17(24)10-16(15)23)28-20(30)26(2)22(34)27(3)21(28)31/h4-10,22,34H,11-12H2,1-3H3 |
| InChIKey | UCTYROKPXBZOQX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|