C11H14FN3O — CID 175516729
2-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridine-6-carboxamide (PubChem CID 175516729) has the molecular formula C11H14FN3O and a molecular weight of 223.25 g/mol. Its IUPAC name is 2-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridine-6-carboxamide.
| Compound Name | 2-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridine-6-carboxamide |
|---|---|
| PubChem CID | 175516729 |
| Molecular Formula | C11H14FN3O |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridine-6-carboxamide |
| SMILES | NC(=O)C1=CC=C(C2=CCNCC2)C(F)N1 |
| InChI | InChI=1S/C11H14FN3O/c12-10-8(7-3-5-14-6-4-7)1-2-9(15-10)11(13)16/h1-3,10,14-15H,4-6H2,(H2,13,16) |
| InChIKey | ZENSTRSBYYKDDQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|