About phenanthrene-1,2-dione;hydrate
phenanthrene-1,2-dione;hydrate (PubChem CID 175517236) has the molecular formula C14H10O3
and a molecular weight of 226.23 g/mol. Its IUPAC name is phenanthrene-1,2-dione;hydrate.
Molecular Properties
| Compound Name | phenanthrene-1,2-dione;hydrate |
| PubChem CID | 175517236 |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | phenanthrene-1,2-dione;hydrate |
| SMILES | O.O=C1C=Cc2c(ccc3ccccc23)C1=O |
| InChI | InChI=1S/C14H8O2.H2O/c15-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)16;/h1-8H;1H2 |
| InChIKey | ZTMSTEYUJORBLK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 65.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze phenanthrene-1,2-dione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene-1,2-dione;hydrate?
The IUPAC name of phenanthrene-1,2-dione;hydrate (CID 175517236) is phenanthrene-1,2-dione;hydrate.
What is the SMILES notation for phenanthrene-1,2-dione;hydrate?
The canonical SMILES for phenanthrene-1,2-dione;hydrate is O.O=C1C=Cc2c(ccc3ccccc23)C1=O.
What is the InChIKey of phenanthrene-1,2-dione;hydrate?
The InChIKey is ZTMSTEYUJORBLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O2.H2O/c15-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)16;/h1-8H;1H2.
What are the key properties of phenanthrene-1,2-dione;hydrate?
phenanthrene-1,2-dione;hydrate has a molecular weight of 226.23 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene-1,2-dione;hydrate is sourced from PubChem (CID 175517236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).