About 2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane
2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane (PubChem CID 175517441) has the molecular formula C12H26N2OSi
and a molecular weight of 242.44 g/mol. Its IUPAC name is 2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane |
| PubChem CID | 175517441 |
| Molecular Formula | C12H26N2OSi |
| Molecular Weight | 242.44 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane |
| SMILES | CCN1C=NC(COCC[Si](C)(C)C)C1C |
| InChI | InChI=1S/C12H26N2OSi/c1-6-14-10-13-12(11(14)2)9-15-7-8-16(3,4)5/h10-12H,6-9H2,1-5H3 |
| InChIKey | JZPVQZDFMUALDZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane?
The IUPAC name of 2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane (CID 175517441) is 2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane.
What is the SMILES notation for 2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane?
The canonical SMILES for 2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane is CCN1C=NC(COCC[Si](C)(C)C)C1C.
What is the InChIKey of 2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane?
The InChIKey is JZPVQZDFMUALDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2OSi/c1-6-14-10-13-12(11(14)2)9-15-7-8-16(3,4)5/h10-12H,6-9H2,1-5H3.
What are the key properties of 2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane?
2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane has a molecular weight of 242.44 g/mol, XLogP of 2.46, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-ethyl-5-methyl-4,5-dihydroimidazol-4-yl)methoxy]ethyl-trimethylsilane is sourced from PubChem (CID 175517441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).