About 2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine
2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine (PubChem CID 175517602) has the molecular formula C21H27Cl2NOS
and a molecular weight of 412.43 g/mol. Its IUPAC name is 2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine.
Molecular Properties
| Compound Name | 2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine |
| PubChem CID | 175517602 |
| Molecular Formula | C21H27Cl2NOS |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine |
| SMILES | Oc1ccc(Cl)cc1Cl.c1csc(C2(N3CCCCC3)CCCCC2)c1 |
| InChI | InChI=1S/C15H23NS.C6H4Cl2O/c1-3-9-15(10-4-1,14-8-7-13-17-14)16-11-5-2-6-12-16;7-4-1-2-6(9)5(8)3-4/h7-8,13H,1-6,9-12H2;1-3,9H |
| InChIKey | TTZNAKZOXVIYHN-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine?
The IUPAC name of 2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine (CID 175517602) is 2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine.
What is the SMILES notation for 2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine?
The canonical SMILES for 2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine is Oc1ccc(Cl)cc1Cl.c1csc(C2(N3CCCCC3)CCCCC2)c1.
What is the InChIKey of 2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine?
The InChIKey is TTZNAKZOXVIYHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NS.C6H4Cl2O/c1-3-9-15(10-4-1,14-8-7-13-17-14)16-11-5-2-6-12-16;7-4-1-2-6(9)5(8)3-4/h7-8,13H,1-6,9-12H2;1-3,9H.
What are the key properties of 2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine?
2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine has a molecular weight of 412.43 g/mol, XLogP of 7.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichlorophenol;1-(1-thiophen-2-ylcyclohexyl)piperidine is sourced from PubChem (CID 175517602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).