C24H18N4O3 — CID 175517742
1-(1H-indol-4-yl)-3-(3-methyl-4-phenoxyphenyl)-1,3,5-triazine-2,4-dione (PubChem CID 175517742) has the molecular formula C24H18N4O3 and a molecular weight of 410.43 g/mol. Its IUPAC name is 1-(1H-indol-4-yl)-3-(3-methyl-4-phenoxyphenyl)-1,3,5-triazine-2,4-dione.
| Compound Name | 1-(1H-indol-4-yl)-3-(3-methyl-4-phenoxyphenyl)-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 175517742 |
| Molecular Formula | C24H18N4O3 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 1-(1H-indol-4-yl)-3-(3-methyl-4-phenoxyphenyl)-1,3,5-triazine-2,4-dione |
| SMILES | Cc1cc(-n2c(=O)ncn(-c3cccc4[nH]ccc34)c2=O)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C24H18N4O3/c1-16-14-17(10-11-22(16)31-18-6-3-2-4-7-18)28-23(29)26-15-27(24(28)30)21-9-5-8-20-19(21)12-13-25-20/h2-15,25H,1H3 |
| InChIKey | GMKBNTAFVQLIBV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |