C41H55N5 — CID 175517995
1-N,4-N,8-N,11-N-tetramethyl-1-N,4-N,8-N,11-N-tetraphenyl-azacyclotetradecane-1,4,8,11-tetramine (PubChem CID 175517995) has the molecular formula C41H55N5 and a molecular weight of 617.93 g/mol. Its IUPAC name is 1-N,4-N,8-N,11-N-tetramethyl-1-N,4-N,8-N,11-N-tetraphenyl-azacyclotetradecane-1,4,8,11-tetramine.
| Compound Name | 1-N,4-N,8-N,11-N-tetramethyl-1-N,4-N,8-N,11-N-tetraphenyl-azacyclotetradecane-1,4,8,11-tetramine |
|---|---|
| PubChem CID | 175517995 |
| Molecular Formula | C41H55N5 |
| Molecular Weight | 617.93 g/mol |
| Exact Mass | 617.45 |
| IUPAC Name | 1-N,4-N,8-N,11-N-tetramethyl-1-N,4-N,8-N,11-N-tetraphenyl-azacyclotetradecane-1,4,8,11-tetramine |
| SMILES | CN(c1ccccc1)C1CCCC(N(C)c2ccccc2)CCN(N(C)c2ccccc2)CCCC(N(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C41H55N5/c1-42(35-19-9-5-10-20-35)38-27-17-28-40(44(3)37-23-13-7-14-24-37)32-34-46(45(4)41-25-15-8-16-26-41)33-18-29-39(31-30-38)43(2)36-21-11-6-12-22-36/h5-16,19-26,38-40H,17-18,27-34H2,1-4H3 |
| InChIKey | YRZAKLAVRGAEEE-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 16.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.93 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |