About methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide
methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide (PubChem CID 175518250) has the molecular formula C20H22BrOP
and a molecular weight of 389.27 g/mol. Its IUPAC name is methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide.
Molecular Properties
| Compound Name | methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide |
| PubChem CID | 175518250 |
| Molecular Formula | C20H22BrOP |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide |
| SMILES | Br.COP(C)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21OP.BrH/c1-21-22(2,18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;/h3-17H,1-2H3;1H |
| InChIKey | SHQUTYGZSLIWRT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide?
The IUPAC name of methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide (CID 175518250) is methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide.
What is the SMILES notation for methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide?
The canonical SMILES for methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide is Br.COP(C)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide?
The InChIKey is SHQUTYGZSLIWRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21OP.BrH/c1-21-22(2,18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;/h3-17H,1-2H3;1H.
What are the key properties of methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide?
methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide has a molecular weight of 389.27 g/mol, XLogP of 4.29, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy-methyl-triphenyl-λ5-phosphane;hydrobromide is sourced from PubChem (CID 175518250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).